C24H21Cl2N3O2 — CID 16977960
3-chloro-N-[2-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16977960) has the molecular formula C24H21Cl2N3O2 and a molecular weight of 454.36 g/mol. Its IUPAC name is 3-chloro-N-[2-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16977960 |
| Molecular Formula | C24H21Cl2N3O2 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 3-chloro-N-[2-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | O=C(NCCc1nc2ccccc2n1CCOc1ccc(Cl)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H21Cl2N3O2/c25-18-8-10-20(11-9-18)31-15-14-29-22-7-2-1-6-21(22)28-23(29)12-13-27-24(30)17-4-3-5-19(26)16-17/h1-11,16H,12-15H2,(H,27,30) |
| InChIKey | AKMIOFHYYWKUQP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |