C27H27BrClN3O2 — CID 16990630
3-bromo-N-[5-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990630) has the molecular formula C27H27BrClN3O2 and a molecular weight of 540.89 g/mol. Its IUPAC name is 3-bromo-N-[5-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3-bromo-N-[5-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990630 |
| Molecular Formula | C27H27BrClN3O2 |
| Molecular Weight | 540.89 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | 3-bromo-N-[5-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | O=C(NCCCCCc1nc2ccccc2n1CCOc1ccc(Cl)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C27H27BrClN3O2/c28-21-8-6-7-20(19-21)27(33)30-16-5-1-2-11-26-31-24-9-3-4-10-25(24)32(26)17-18-34-23-14-12-22(29)13-15-23/h3-4,6-10,12-15,19H,1-2,5,11,16-18H2,(H,30,33) |
| InChIKey | RDEPUEFRAOZWTO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.89 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|