C31H36ClN3O2 — CID 16990522
3-chloro-N-[5-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990522) has the molecular formula C31H36ClN3O2 and a molecular weight of 518.10 g/mol. Its IUPAC name is 3-chloro-N-[5-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3-chloro-N-[5-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990522 |
| Molecular Formula | C31H36ClN3O2 |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 3-chloro-N-[5-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | Cc1cc(C)cc(OCCCCn2c(CCCCCNC(=O)c3cccc(Cl)c3)nc3ccccc32)c1 |
| InChI | InChI=1S/C31H36ClN3O2/c1-23-19-24(2)21-27(20-23)37-18-9-8-17-35-29-14-6-5-13-28(29)34-30(35)15-4-3-7-16-33-31(36)25-11-10-12-26(32)22-25/h5-6,10-14,19-22H,3-4,7-9,15-18H2,1-2H3,(H,33,36) |
| InChIKey | DWVFTSNVYLSDST-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|