C30H34ClN3O3 — CID 16993210
2-(4-chlorophenoxy)-N-[5-[1-[2-(2,6-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993210) has the molecular formula C30H34ClN3O3 and a molecular weight of 520.07 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[5-[1-[2-(2,6-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[5-[1-[2-(2,6-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993210 |
| Molecular Formula | C30H34ClN3O3 |
| Molecular Weight | 520.07 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[5-[1-[2-(2,6-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | Cc1cccc(C)c1OCCn1c(CCCCCNC(=O)COc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C30H34ClN3O3/c1-22-9-8-10-23(2)30(22)36-20-19-34-27-12-6-5-11-26(27)33-28(34)13-4-3-7-18-32-29(35)21-37-25-16-14-24(31)15-17-25/h5-6,8-12,14-17H,3-4,7,13,18-21H2,1-2H3,(H,32,35) |
| InChIKey | PEGPTZBMANSIPG-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.07 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|