C31H36ClN3O3 — CID 16993314
2-(4-chlorophenoxy)-N-[5-[1-[4-(4-methylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993314) has the molecular formula C31H36ClN3O3 and a molecular weight of 534.10 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[5-[1-[4-(4-methylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[5-[1-[4-(4-methylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993314 |
| Molecular Formula | C31H36ClN3O3 |
| Molecular Weight | 534.10 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[5-[1-[4-(4-methylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | Cc1ccc(OCCCCn2c(CCCCCNC(=O)COc3ccc(Cl)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C31H36ClN3O3/c1-24-12-16-26(17-13-24)37-22-8-7-21-35-29-10-5-4-9-28(29)34-30(35)11-3-2-6-20-33-31(36)23-38-27-18-14-25(32)15-19-27/h4-5,9-10,12-19H,2-3,6-8,11,20-23H2,1H3,(H,33,36) |
| InChIKey | UKFIJFBGDGOJOR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.10 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|