C30H34ClN3O4 — CID 16993214
2-(4-chlorophenoxy)-N-[5-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993214) has the molecular formula C30H34ClN3O4 and a molecular weight of 536.07 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[5-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[5-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993214 |
| Molecular Formula | C30H34ClN3O4 |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[5-[1-[2-(2-ethoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | CCOc1ccccc1OCCn1c(CCCCCNC(=O)COc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C30H34ClN3O4/c1-2-36-27-12-7-8-13-28(27)37-21-20-34-26-11-6-5-10-25(26)33-29(34)14-4-3-9-19-32-30(35)22-38-24-17-15-23(31)16-18-24/h5-8,10-13,15-18H,2-4,9,14,19-22H2,1H3,(H,32,35) |
| InChIKey | APWPJHJOTIQDMA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|