C29H39ClN4O2 — CID 16990536
N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-chlorobenzamide (PubChem CID 16990536) has the molecular formula C29H39ClN4O2 and a molecular weight of 511.11 g/mol. Its IUPAC name is N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-chlorobenzamide.
| Compound Name | N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 16990536 |
| Molecular Formula | C29H39ClN4O2 |
| Molecular Weight | 511.11 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-chlorobenzamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)Cn1c(CCCCCNC(=O)c2cccc(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C29H39ClN4O2/c1-21(2)18-33(19-22(3)4)28(35)20-34-26-14-8-7-13-25(26)32-27(34)15-6-5-9-16-31-29(36)23-11-10-12-24(30)17-23/h7-8,10-14,17,21-22H,5-6,9,15-16,18-20H2,1-4H3,(H,31,36) |
| InChIKey | UTILNAQJJICQQH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.11 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|