C25H40N4O2 — CID 16988106
N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]propanamide (PubChem CID 16988106) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]propanamide.
| Compound Name | N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]propanamide |
|---|---|
| PubChem CID | 16988106 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]propanamide |
| SMILES | CCC(=O)NCCCCCc1nc2ccccc2n1CC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C25H40N4O2/c1-6-24(30)26-15-11-7-8-14-23-27-21-12-9-10-13-22(21)29(23)18-25(31)28(16-19(2)3)17-20(4)5/h9-10,12-13,19-20H,6-8,11,14-18H2,1-5H3,(H,26,30) |
| InChIKey | ZTKAFBMKKLNUCX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|