C23H36N4O3 — CID 16981382
2-[2-[3-[(2-methoxyacetyl)amino]propyl]benzimidazol-1-yl]-N,N-bis(2-methylpropyl)acetamide (PubChem CID 16981382) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[2-[3-[(2-methoxyacetyl)amino]propyl]benzimidazol-1-yl]-N,N-bis(2-methylpropyl)acetamide.
| Compound Name | 2-[2-[3-[(2-methoxyacetyl)amino]propyl]benzimidazol-1-yl]-N,N-bis(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 16981382 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 2-[2-[3-[(2-methoxyacetyl)amino]propyl]benzimidazol-1-yl]-N,N-bis(2-methylpropyl)acetamide |
| SMILES | COCC(=O)NCCCc1nc2ccccc2n1CC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C23H36N4O3/c1-17(2)13-26(14-18(3)4)23(29)15-27-20-10-7-6-9-19(20)25-21(27)11-8-12-24-22(28)16-30-5/h6-7,9-10,17-18H,8,11-16H2,1-5H3,(H,24,28) |
| InChIKey | KBIWEGZCZHUYTL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|