C31H44N4O2 — CID 16992642
N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylpropanamide (PubChem CID 16992642) has the molecular formula C31H44N4O2 and a molecular weight of 504.72 g/mol. Its IUPAC name is N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylpropanamide.
| Compound Name | N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 16992642 |
| Molecular Formula | C31H44N4O2 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylpropanamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)Cn1c(CCCCCNC(=O)CCc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C31H44N4O2/c1-24(2)21-34(22-25(3)4)31(37)23-35-28-16-11-10-15-27(28)33-29(35)17-9-6-12-20-32-30(36)19-18-26-13-7-5-8-14-26/h5,7-8,10-11,13-16,24-25H,6,9,12,17-23H2,1-4H3,(H,32,36) |
| InChIKey | RVWPXEZKXHWDQW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|