C26H40N4O2 — CID 16992480
N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-methylprop-2-enamide (PubChem CID 16992480) has the molecular formula C26H40N4O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-methylprop-2-enamide.
| Compound Name | N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 16992480 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | N-[5-[1-[2-[bis(2-methylpropyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCc1nc2ccccc2n1CC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C26H40N4O2/c1-19(2)16-29(17-20(3)4)25(31)18-30-23-13-10-9-12-22(23)28-24(30)14-8-7-11-15-27-26(32)21(5)6/h9-10,12-13,19-20H,5,7-8,11,14-18H2,1-4,6H3,(H,27,32) |
| InChIKey | FMWLQUFQSIDQCH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|