C20H29N3O3 — CID 16988124
propan-2-yl 2-[2-[5-(propanoylamino)pentyl]benzimidazol-1-yl]acetate (PubChem CID 16988124) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is propan-2-yl 2-[2-[5-(propanoylamino)pentyl]benzimidazol-1-yl]acetate.
| Compound Name | propan-2-yl 2-[2-[5-(propanoylamino)pentyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 16988124 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | propan-2-yl 2-[2-[5-(propanoylamino)pentyl]benzimidazol-1-yl]acetate |
| SMILES | CCC(=O)NCCCCCc1nc2ccccc2n1CC(=O)OC(C)C |
| InChI | InChI=1S/C20H29N3O3/c1-4-19(24)21-13-9-5-6-12-18-22-16-10-7-8-11-17(16)23(18)14-20(25)26-15(2)3/h7-8,10-11,15H,4-6,9,12-14H2,1-3H3,(H,21,24) |
| InChIKey | NEAFAJLAKDMCFT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|