C22H23BrClN3O — CID 16990406
N-[5-[1-(2-bromoprop-2-enyl)benzimidazol-2-yl]pentyl]-3-chlorobenzamide (PubChem CID 16990406) has the molecular formula C22H23BrClN3O and a molecular weight of 460.80 g/mol. Its IUPAC name is N-[5-[1-(2-bromoprop-2-enyl)benzimidazol-2-yl]pentyl]-3-chlorobenzamide.
| Compound Name | N-[5-[1-(2-bromoprop-2-enyl)benzimidazol-2-yl]pentyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 16990406 |
| Molecular Formula | C22H23BrClN3O |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | N-[5-[1-(2-bromoprop-2-enyl)benzimidazol-2-yl]pentyl]-3-chlorobenzamide |
| SMILES | C=C(Br)Cn1c(CCCCCNC(=O)c2cccc(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C22H23BrClN3O/c1-16(23)15-27-20-11-5-4-10-19(20)26-21(27)12-3-2-6-13-25-22(28)17-8-7-9-18(24)14-17/h4-5,7-11,14H,1-3,6,12-13,15H2,(H,25,28) |
| InChIKey | KLFZFDHSYKBAKI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|