C30H31ClN4O2 — CID 16990550
3-chloro-N-[5-[1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990550) has the molecular formula C30H31ClN4O2 and a molecular weight of 515.06 g/mol. Its IUPAC name is 3-chloro-N-[5-[1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3-chloro-N-[5-[1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990550 |
| Molecular Formula | C30H31ClN4O2 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 3-chloro-N-[5-[1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | O=C(NCCCCCc1nc2ccccc2n1CC(=O)N1CCCc2ccccc21)c1cccc(Cl)c1 |
| InChI | InChI=1S/C30H31ClN4O2/c31-24-13-8-11-23(20-24)30(37)32-18-7-1-2-17-28-33-25-14-4-6-16-27(25)35(28)21-29(36)34-19-9-12-22-10-3-5-15-26(22)34/h3-6,8,10-11,13-16,20H,1-2,7,9,12,17-19,21H2,(H,32,37) |
| InChIKey | JSPQBPFNQVUSBB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|