C27H29N3O2 — CID 16976706
4-methoxy-N-[2-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16976706) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-methoxy-N-[2-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16976706 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 4-methoxy-N-[2-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCc2nc3ccccc3n2Cc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H29N3O2/c1-19(2)21-10-8-20(9-11-21)18-30-25-7-5-4-6-24(25)29-26(30)16-17-28-27(31)22-12-14-23(32-3)15-13-22/h4-15,19H,16-18H2,1-3H3,(H,28,31) |
| InChIKey | MOOUXEHVMQPMRN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |