C23H21N3O2 — CID 17006669
N-[[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17006669) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | N-[[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17006669 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | COc1ccc(Cn2c(CNC(=O)c3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H21N3O2/c1-28-19-13-11-17(12-14-19)16-26-21-10-6-5-9-20(21)25-22(26)15-24-23(27)18-7-3-2-4-8-18/h2-14H,15-16H2,1H3,(H,24,27) |
| InChIKey | BIOHFKIULKPHJQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |