C24H29N3O — CID 16992370
2-methyl-N-[5-[1-[(3-methylphenyl)methyl]benzimidazol-2-yl]pentyl]prop-2-enamide (PubChem CID 16992370) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-methyl-N-[5-[1-[(3-methylphenyl)methyl]benzimidazol-2-yl]pentyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[5-[1-[(3-methylphenyl)methyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 16992370 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2-methyl-N-[5-[1-[(3-methylphenyl)methyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCc1nc2ccccc2n1Cc1cccc(C)c1 |
| InChI | InChI=1S/C24H29N3O/c1-18(2)24(28)25-15-8-4-5-14-23-26-21-12-6-7-13-22(21)27(23)17-20-11-9-10-19(3)16-20/h6-7,9-13,16H,1,4-5,8,14-15,17H2,2-3H3,(H,25,28) |
| InChIKey | GGKQPNMACLLPKI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|