C21H23Cl2N3O — CID 16987846
N-[5-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16987846) has the molecular formula C21H23Cl2N3O and a molecular weight of 404.34 g/mol. Its IUPAC name is N-[5-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | N-[5-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16987846 |
| Molecular Formula | C21H23Cl2N3O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[5-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | CC(=O)NCCCCCc1nc2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H23Cl2N3O/c1-15(27)24-12-6-2-3-9-21-25-19-7-4-5-8-20(19)26(21)14-16-10-11-17(22)18(23)13-16/h4-5,7-8,10-11,13H,2-3,6,9,12,14H2,1H3,(H,24,27) |
| InChIKey | ARNRRNKUEOYAKA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|