C27H26Cl3N3O — CID 16993675
2-(2-chlorophenyl)-N-[5-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993675) has the molecular formula C27H26Cl3N3O and a molecular weight of 514.88 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[5-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[5-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993675 |
| Molecular Formula | C27H26Cl3N3O |
| Molecular Weight | 514.88 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[5-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | O=C(Cc1ccccc1Cl)NCCCCCc1nc2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H26Cl3N3O/c28-21-9-4-3-8-20(21)17-27(34)31-15-7-1-2-12-26-32-24-10-5-6-11-25(24)33(26)18-19-13-14-22(29)23(30)16-19/h3-6,8-11,13-14,16H,1-2,7,12,15,17-18H2,(H,31,34) |
| InChIKey | JKTAKYJBARBSGI-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.88 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|