C30H34BrN3O — CID 16990589
3-bromo-N-[5-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990589) has the molecular formula C30H34BrN3O and a molecular weight of 532.53 g/mol. Its IUPAC name is 3-bromo-N-[5-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3-bromo-N-[5-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990589 |
| Molecular Formula | C30H34BrN3O |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 3-bromo-N-[5-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | Cc1cc(C)c(C)c(Cn2c(CCCCCNC(=O)c3cccc(Br)c3)nc3ccccc32)c1C |
| InChI | InChI=1S/C30H34BrN3O/c1-20-17-21(2)23(4)26(22(20)3)19-34-28-14-8-7-13-27(28)33-29(34)15-6-5-9-16-32-30(35)24-11-10-12-25(31)18-24/h7-8,10-14,17-18H,5-6,9,15-16,19H2,1-4H3,(H,32,35) |
| InChIKey | OEUGEPOJVBSFBH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|