C28H36N4O5 — CID 16994273
2-(3,4-dimethoxyphenyl)-N-[5-[1-(2-morpholin-4-yl-2-oxoethyl)benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16994273) has the molecular formula C28H36N4O5 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-[1-(2-morpholin-4-yl-2-oxoethyl)benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-[1-(2-morpholin-4-yl-2-oxoethyl)benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16994273 |
| Molecular Formula | C28H36N4O5 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-[1-(2-morpholin-4-yl-2-oxoethyl)benzimidazol-2-yl]pentyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCCCCc2nc3ccccc3n2CC(=O)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C28H36N4O5/c1-35-24-12-11-21(18-25(24)36-2)19-27(33)29-13-7-3-4-10-26-30-22-8-5-6-9-23(22)32(26)20-28(34)31-14-16-37-17-15-31/h5-6,8-9,11-12,18H,3-4,7,10,13-17,19-20H2,1-2H3,(H,29,33) |
| InChIKey | UMOIYFJRZPFSPK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|