C31H36N4O4 — CID 16994266
2-(3,4-dimethoxyphenyl)-N-[5-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16994266) has the molecular formula C31H36N4O4 and a molecular weight of 528.65 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16994266 |
| Molecular Formula | C31H36N4O4 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCCCCc2nc3ccccc3n2CC(=O)N(C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C31H36N4O4/c1-34(24-12-6-4-7-13-24)31(37)22-35-26-15-10-9-14-25(26)33-29(35)16-8-5-11-19-32-30(36)21-23-17-18-27(38-2)28(20-23)39-3/h4,6-7,9-10,12-15,17-18,20H,5,8,11,16,19,21-22H2,1-3H3,(H,32,36) |
| InChIKey | INSUNAPUIUCMBQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|