C26H32N4O5 — CID 16985813
2-(3,4-dimethoxyphenyl)-N-[3-[1-(2-morpholin-4-yl-2-oxoethyl)benzimidazol-2-yl]propyl]acetamide (PubChem CID 16985813) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[3-[1-(2-morpholin-4-yl-2-oxoethyl)benzimidazol-2-yl]propyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[3-[1-(2-morpholin-4-yl-2-oxoethyl)benzimidazol-2-yl]propyl]acetamide |
|---|---|
| PubChem CID | 16985813 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[3-[1-(2-morpholin-4-yl-2-oxoethyl)benzimidazol-2-yl]propyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCCc2nc3ccccc3n2CC(=O)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C26H32N4O5/c1-33-22-10-9-19(16-23(22)34-2)17-25(31)27-11-5-8-24-28-20-6-3-4-7-21(20)30(24)18-26(32)29-12-14-35-15-13-29/h3-4,6-7,9-10,16H,5,8,11-15,17-18H2,1-2H3,(H,27,31) |
| InChIKey | ICOVKIVTQFDZBW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|