C32H38N4O4 — CID 16994269
N-[5-[1-[2-[benzyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 16994269) has the molecular formula C32H38N4O4 and a molecular weight of 542.68 g/mol. Its IUPAC name is N-[5-[1-[2-[benzyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[5-[1-[2-[benzyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16994269 |
| Molecular Formula | C32H38N4O4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | N-[5-[1-[2-[benzyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCCCCc2nc3ccccc3n2CC(=O)N(C)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C32H38N4O4/c1-35(22-24-12-6-4-7-13-24)32(38)23-36-27-15-10-9-14-26(27)34-30(36)16-8-5-11-19-33-31(37)21-25-17-18-28(39-2)29(20-25)40-3/h4,6-7,9-10,12-15,17-18,20H,5,8,11,16,19,21-23H2,1-3H3,(H,33,37) |
| InChIKey | NRKRACVDCZBJLP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|