C29H32N4O2 — CID 16989409
N-[5-[1-[2-[benzyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16989409) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[5-[1-[2-[benzyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | N-[5-[1-[2-[benzyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16989409 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-[5-[1-[2-[benzyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | CN(Cc1ccccc1)C(=O)Cn1c(CCCCCNC(=O)c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C29H32N4O2/c1-32(21-23-13-5-2-6-14-23)28(34)22-33-26-18-11-10-17-25(26)31-27(33)19-9-4-12-20-30-29(35)24-15-7-3-8-16-24/h2-3,5-8,10-11,13-18H,4,9,12,19-22H2,1H3,(H,30,35) |
| InChIKey | RHDCFJDOAVFGGB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|