C28H30N4O3 — CID 16986352
N-benzyl-N-methyl-2-[2-[3-[(2-phenoxyacetyl)amino]propyl]benzimidazol-1-yl]acetamide (PubChem CID 16986352) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[2-[3-[(2-phenoxyacetyl)amino]propyl]benzimidazol-1-yl]acetamide.
| Compound Name | N-benzyl-N-methyl-2-[2-[3-[(2-phenoxyacetyl)amino]propyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 16986352 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-benzyl-N-methyl-2-[2-[3-[(2-phenoxyacetyl)amino]propyl]benzimidazol-1-yl]acetamide |
| SMILES | CN(Cc1ccccc1)C(=O)Cn1c(CCCNC(=O)COc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C28H30N4O3/c1-31(19-22-11-4-2-5-12-22)28(34)20-32-25-16-9-8-15-24(25)30-26(32)17-10-18-29-27(33)21-35-23-13-6-3-7-14-23/h2-9,11-16H,10,17-21H2,1H3,(H,29,33) |
| InChIKey | NZTUCYDFYUHCKO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|