C30H34N4O3 — CID 16992973
N-benzyl-N-methyl-2-[2-[5-[(2-phenoxyacetyl)amino]pentyl]benzimidazol-1-yl]acetamide (PubChem CID 16992973) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[2-[5-[(2-phenoxyacetyl)amino]pentyl]benzimidazol-1-yl]acetamide.
| Compound Name | N-benzyl-N-methyl-2-[2-[5-[(2-phenoxyacetyl)amino]pentyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 16992973 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | N-benzyl-N-methyl-2-[2-[5-[(2-phenoxyacetyl)amino]pentyl]benzimidazol-1-yl]acetamide |
| SMILES | CN(Cc1ccccc1)C(=O)Cn1c(CCCCCNC(=O)COc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C30H34N4O3/c1-33(21-24-13-5-2-6-14-24)30(36)22-34-27-18-11-10-17-26(27)32-28(34)19-9-4-12-20-31-29(35)23-37-25-15-7-3-8-16-25/h2-3,5-8,10-11,13-18H,4,9,12,19-23H2,1H3,(H,31,35) |
| InChIKey | ZYKLTOUYGLUSNA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|