C26H33ClN4O3 — CID 16993286
2-[2-[5-[[2-(4-chlorophenoxy)acetyl]amino]pentyl]benzimidazol-1-yl]-N,N-diethylacetamide (PubChem CID 16993286) has the molecular formula C26H33ClN4O3 and a molecular weight of 485.03 g/mol. Its IUPAC name is 2-[2-[5-[[2-(4-chlorophenoxy)acetyl]amino]pentyl]benzimidazol-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[2-[5-[[2-(4-chlorophenoxy)acetyl]amino]pentyl]benzimidazol-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 16993286 |
| Molecular Formula | C26H33ClN4O3 |
| Molecular Weight | 485.03 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 2-[2-[5-[[2-(4-chlorophenoxy)acetyl]amino]pentyl]benzimidazol-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1c(CCCCCNC(=O)COc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C26H33ClN4O3/c1-3-30(4-2)26(33)18-31-23-11-8-7-10-22(23)29-24(31)12-6-5-9-17-28-25(32)19-34-21-15-13-20(27)14-16-21/h7-8,10-11,13-16H,3-6,9,12,17-19H2,1-2H3,(H,28,32) |
| InChIKey | QZICEVKFFLFQPK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.03 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|