C27H36N4O3 — CID 16990861
N-[5-[1-[2-[butyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-methoxybenzamide (PubChem CID 16990861) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[5-[1-[2-[butyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-methoxybenzamide.
| Compound Name | N-[5-[1-[2-[butyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 16990861 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | N-[5-[1-[2-[butyl(methyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-methoxybenzamide |
| SMILES | CCCCN(C)C(=O)Cn1c(CCCCCNC(=O)c2cccc(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C27H36N4O3/c1-4-5-18-30(2)26(32)20-31-24-15-9-8-14-23(24)29-25(31)16-7-6-10-17-28-27(33)21-12-11-13-22(19-21)34-3/h8-9,11-15,19H,4-7,10,16-18,20H2,1-3H3,(H,28,33) |
| InChIKey | FLZOIOOIGYZWHT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|