C18H17Cl2N3O — CID 4886388
N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]formamide (PubChem CID 4886388) has the molecular formula C18H17Cl2N3O and a molecular weight of 362.26 g/mol. Its IUPAC name is N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]formamide.
| Compound Name | N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]formamide |
|---|---|
| PubChem CID | 4886388 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]formamide |
| SMILES | O=CNCCCc1nc2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O/c19-14-8-7-13(15(20)10-14)11-23-17-5-2-1-4-16(17)22-18(23)6-3-9-21-12-24/h1-2,4-5,7-8,10,12H,3,6,9,11H2,(H,21,24) |
| InChIKey | KXQWCYUIOWMBSA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|