C20H19Cl2N3O — CID 16980393
N-[2-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-2-methylprop-2-enamide (PubChem CID 16980393) has the molecular formula C20H19Cl2N3O and a molecular weight of 388.30 g/mol. Its IUPAC name is N-[2-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 16980393 |
| Molecular Formula | C20H19Cl2N3O |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[2-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCc1nc2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl2N3O/c1-13(2)20(26)23-10-9-19-24-17-5-3-4-6-18(17)25(19)12-14-7-8-15(21)11-16(14)22/h3-8,11H,1,9-10,12H2,2H3,(H,23,26) |
| InChIKey | GMZGZSNRPAQGMP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|