C25H21Cl2N3O — CID 16970293
(Z)-N-[1-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 16970293) has the molecular formula C25H21Cl2N3O and a molecular weight of 450.37 g/mol. Its IUPAC name is (Z)-N-[1-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[1-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16970293 |
| Molecular Formula | C25H21Cl2N3O |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | (Z)-N-[1-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | CC(NC(=O)/C=C\c1ccccc1)c1nc2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H21Cl2N3O/c1-17(28-24(31)14-11-18-7-3-2-4-8-18)25-29-22-9-5-6-10-23(22)30(25)16-19-12-13-20(26)15-21(19)27/h2-15,17H,16H2,1H3,(H,28,31)/b14-11- |
| InChIKey | MNBLPXHPAFBOJJ-KAMYIIQDSA-N |
| XLogP | 6.28 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|