C28H28ClN3O2 — CID 16970378
(Z)-N-[1-[1-[4-(2-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 16970378) has the molecular formula C28H28ClN3O2 and a molecular weight of 474.00 g/mol. Its IUPAC name is (Z)-N-[1-[1-[4-(2-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[1-[1-[4-(2-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16970378 |
| Molecular Formula | C28H28ClN3O2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | (Z)-N-[1-[1-[4-(2-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | CC(NC(=O)/C=C\c1ccccc1)c1nc2ccccc2n1CCCCOc1ccccc1Cl |
| InChI | InChI=1S/C28H28ClN3O2/c1-21(30-27(33)18-17-22-11-3-2-4-12-22)28-31-24-14-6-7-15-25(24)32(28)19-9-10-20-34-26-16-8-5-13-23(26)29/h2-8,11-18,21H,9-10,19-20H2,1H3,(H,30,33)/b18-17- |
| InChIKey | SEOMHTCLGFJWNN-ZCXUNETKSA-N |
| XLogP | 6.44 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|