C31H35N3O2 — CID 16970387
(Z)-3-phenyl-N-[1-[1-[4-(4-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]prop-2-enamide (PubChem CID 16970387) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is (Z)-3-phenyl-N-[1-[1-[4-(4-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]prop-2-enamide.
| Compound Name | (Z)-3-phenyl-N-[1-[1-[4-(4-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 16970387 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | (Z)-3-phenyl-N-[1-[1-[4-(4-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]prop-2-enamide |
| SMILES | CC(C)c1ccc(OCCCCn2c(C(C)NC(=O)/C=C\c3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C31H35N3O2/c1-23(2)26-16-18-27(19-17-26)36-22-10-9-21-34-29-14-8-7-13-28(29)33-31(34)24(3)32-30(35)20-15-25-11-5-4-6-12-25/h4-8,11-20,23-24H,9-10,21-22H2,1-3H3,(H,32,35)/b20-15- |
| InChIKey | VMIDTOUWAMMGEE-HKWRFOASSA-N |
| XLogP | 6.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|