C27H26ClN3O2 — CID 16970870
(Z)-N-[[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 16970870) has the molecular formula C27H26ClN3O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is (Z)-N-[[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16970870 |
| Molecular Formula | C27H26ClN3O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (Z)-N-[[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C\c1ccccc1)NCc1nc2ccccc2n1CCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H26ClN3O2/c28-22-13-15-23(16-14-22)33-19-7-6-18-31-25-11-5-4-10-24(25)30-26(31)20-29-27(32)17-12-21-8-2-1-3-9-21/h1-5,8-17H,6-7,18-20H2,(H,29,32)/b17-12- |
| InChIKey | JATFIGORJZHETQ-ATVHPVEESA-N |
| XLogP | 5.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|