C30H33N3O2 — CID 18889339
(E)-N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 18889339) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is (E)-N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18889339 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | (E)-N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | Cc1cc(C)cc(OCCCCn2c(CCNC(=O)/C=C/c3ccccc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C30H33N3O2/c1-23-20-24(2)22-26(21-23)35-19-9-8-18-33-28-13-7-6-12-27(28)32-29(33)16-17-31-30(34)15-14-25-10-4-3-5-11-25/h3-7,10-15,20-22H,8-9,16-19H2,1-2H3,(H,31,34)/b15-14+ |
| InChIKey | GNGZCBVNFOFEMK-CCEZHUSRSA-N |
| XLogP | 5.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|