C28H29N3O2 — CID 16978406
(E)-N-[2-[1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 16978406) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is (E)-N-[2-[1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16978406 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (E)-N-[2-[1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(OCCn2c(CCNC(=O)/C=C/c3ccccc3)nc3ccccc32)cc1C |
| InChI | InChI=1S/C28H29N3O2/c1-21-12-14-24(20-22(21)2)33-19-18-31-26-11-7-6-10-25(26)30-27(31)16-17-29-28(32)15-13-23-8-4-3-5-9-23/h3-15,20H,16-19H2,1-2H3,(H,29,32)/b15-13+ |
| InChIKey | SAAIVLNJJRJUOP-FYWRMAATSA-N |
| XLogP | 5.10 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|