C29H31N3O — CID 18888947
(E)-3-phenyl-N-[2-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]ethyl]prop-2-enamide (PubChem CID 18888947) has the molecular formula C29H31N3O and a molecular weight of 437.59 g/mol. Its IUPAC name is (E)-3-phenyl-N-[2-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[2-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 18888947 |
| Molecular Formula | C29H31N3O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (E)-3-phenyl-N-[2-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]ethyl]prop-2-enamide |
| SMILES | Cc1cc(C)c(C)c(Cn2c(CCNC(=O)/C=C/c3ccccc3)nc3ccccc32)c1C |
| InChI | InChI=1S/C29H31N3O/c1-20-18-21(2)23(4)25(22(20)3)19-32-27-13-9-8-12-26(27)31-28(32)16-17-30-29(33)15-14-24-10-6-5-7-11-24/h5-15,18H,16-17,19H2,1-4H3,(H,30,33)/b15-14+ |
| InChIKey | VXOGMBLXVYGTIR-CCEZHUSRSA-N |
| XLogP | 5.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|