C32H37N3O2 — CID 18889329
(E)-N-[2-[1-[4-(2-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 18889329) has the molecular formula C32H37N3O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is (E)-N-[2-[1-[4-(2-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[1-[4-(2-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18889329 |
| Molecular Formula | C32H37N3O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | (E)-N-[2-[1-[4-(2-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | CC(C)(C)c1ccccc1OCCCCn1c(CCNC(=O)/C=C/c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C32H37N3O2/c1-32(2,3)26-15-7-10-18-29(26)37-24-12-11-23-35-28-17-9-8-16-27(28)34-30(35)21-22-33-31(36)20-19-25-13-5-4-6-14-25/h4-10,13-20H,11-12,21-24H2,1-3H3,(H,33,36)/b20-19+ |
| InChIKey | PXTFLDOVDGKQKV-FMQUCBEESA-N |
| XLogP | 6.57 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|