C35H43N3O2 — CID 16992780
(E)-N-[5-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide (PubChem CID 16992780) has the molecular formula C35H43N3O2 and a molecular weight of 537.75 g/mol. Its IUPAC name is (E)-N-[5-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[5-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16992780 |
| Molecular Formula | C35H43N3O2 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.34 |
| IUPAC Name | (E)-N-[5-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(C(C)C)c(OCCCCn2c(CCCCCNC(=O)/C=C/c3ccccc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C35H43N3O2/c1-27(2)30-21-19-28(3)26-33(30)40-25-13-12-24-38-32-17-10-9-16-31(32)37-34(38)18-8-5-11-23-36-35(39)22-20-29-14-6-4-7-15-29/h4,6-7,9-10,14-17,19-22,26-27H,5,8,11-13,18,23-25H2,1-3H3,(H,36,39)/b22-20+ |
| InChIKey | FKJCWHNJGCTMOF-LSDHQDQOSA-N |
| XLogP | 7.87 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|