C38H43N3O2 — CID 16994345
N-[5-[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16994345) has the molecular formula C38H43N3O2 and a molecular weight of 573.78 g/mol. Its IUPAC name is N-[5-[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[5-[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16994345 |
| Molecular Formula | C38H43N3O2 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | N-[5-[1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide |
| SMILES | Cc1ccc(C(C)C)c(OCCn2c(CCCCCNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C38H43N3O2/c1-28(2)33-22-17-29(3)26-36(33)43-25-24-41-35-15-10-9-14-34(35)40-37(41)16-8-5-11-23-39-38(42)27-30-18-20-32(21-19-30)31-12-6-4-7-13-31/h4,6-7,9-10,12-15,17-22,26,28H,5,8,11,16,23-25,27H2,1-3H3,(H,39,42) |
| InChIKey | IUWGEKDLQSJHOH-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|