C34H41N3O2 — CID 16992751
(E)-N-[5-[1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide (PubChem CID 16992751) has the molecular formula C34H41N3O2 and a molecular weight of 523.72 g/mol. Its IUPAC name is (E)-N-[5-[1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[5-[1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16992751 |
| Molecular Formula | C34H41N3O2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | (E)-N-[5-[1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(C(C)C)c(OCCCn2c(CCCCCNC(=O)/C=C/c3ccccc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C34H41N3O2/c1-26(2)29-20-18-27(3)25-32(29)39-24-12-23-37-31-16-10-9-15-30(31)36-33(37)17-8-5-11-22-35-34(38)21-19-28-13-6-4-7-14-28/h4,6-7,9-10,13-16,18-21,25-26H,5,8,11-12,17,22-24H2,1-3H3,(H,35,38)/b21-19+ |
| InChIKey | KDNAGQIMAVJUNC-XUTLUUPISA-N |
| XLogP | 7.48 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|