C27H28ClN3O4 — CID 16971189
2-(4-chlorophenoxy)-N-[[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide (PubChem CID 16971189) has the molecular formula C27H28ClN3O4 and a molecular weight of 493.99 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 16971189 |
| Molecular Formula | C27H28ClN3O4 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[1-[4-(4-methoxyphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide |
| SMILES | COc1ccc(OCCCCn2c(CNC(=O)COc3ccc(Cl)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C27H28ClN3O4/c1-33-21-12-14-22(15-13-21)34-17-5-4-16-31-25-7-3-2-6-24(25)30-26(31)18-29-27(32)19-35-23-10-8-20(28)9-11-23/h2-3,6-15H,4-5,16-19H2,1H3,(H,29,32) |
| InChIKey | LHDUQVRIIIFOGU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|