C24H30ClN3O2 — CID 16971079
2-(4-chlorophenoxy)-N-[(1-octylbenzimidazol-2-yl)methyl]acetamide (PubChem CID 16971079) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(1-octylbenzimidazol-2-yl)methyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(1-octylbenzimidazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 16971079 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(1-octylbenzimidazol-2-yl)methyl]acetamide |
| SMILES | CCCCCCCCn1c(CNC(=O)COc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C24H30ClN3O2/c1-2-3-4-5-6-9-16-28-22-11-8-7-10-21(22)27-23(28)17-26-24(29)18-30-20-14-12-19(25)13-15-20/h7-8,10-15H,2-6,9,16-18H2,1H3,(H,26,29) |
| InChIKey | DQRDLKIBGSQVRT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|