C28H30ClN3O3 — CID 16971175
2-(4-chlorophenoxy)-N-[[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide (PubChem CID 16971175) has the molecular formula C28H30ClN3O3 and a molecular weight of 492.02 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 16971175 |
| Molecular Formula | C28H30ClN3O3 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide |
| SMILES | Cc1ccc(C)c(OCCCCn2c(CNC(=O)COc3ccc(Cl)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C28H30ClN3O3/c1-20-9-10-21(2)26(17-20)34-16-6-5-15-32-25-8-4-3-7-24(25)31-27(32)18-30-28(33)19-35-23-13-11-22(29)12-14-23/h3-4,7-14,17H,5-6,15-16,18-19H2,1-2H3,(H,30,33) |
| InChIKey | JOWYCXRNNMILHP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|