C29H32ClN3O3 — CID 16978720
N-[2-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(2,5-dimethylphenoxy)acetamide (PubChem CID 16978720) has the molecular formula C29H32ClN3O3 and a molecular weight of 506.05 g/mol. Its IUPAC name is N-[2-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(2,5-dimethylphenoxy)acetamide.
| Compound Name | N-[2-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 16978720 |
| Molecular Formula | C29H32ClN3O3 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[2-[1-[4-(4-chlorophenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(2,5-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NCCc2nc3ccccc3n2CCCCOc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C29H32ClN3O3/c1-21-9-10-22(2)27(19-21)36-20-29(34)31-16-15-28-32-25-7-3-4-8-26(25)33(28)17-5-6-18-35-24-13-11-23(30)12-14-24/h3-4,7-14,19H,5-6,15-18,20H2,1-2H3,(H,31,34) |
| InChIKey | IEHHKIGIEXSEJW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|