C23H29N3O2 — CID 16978605
N-[2-(1-butylbenzimidazol-2-yl)ethyl]-2-(2,5-dimethylphenoxy)acetamide (PubChem CID 16978605) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[2-(1-butylbenzimidazol-2-yl)ethyl]-2-(2,5-dimethylphenoxy)acetamide.
| Compound Name | N-[2-(1-butylbenzimidazol-2-yl)ethyl]-2-(2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 16978605 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[2-(1-butylbenzimidazol-2-yl)ethyl]-2-(2,5-dimethylphenoxy)acetamide |
| SMILES | CCCCn1c(CCNC(=O)COc2cc(C)ccc2C)nc2ccccc21 |
| InChI | InChI=1S/C23H29N3O2/c1-4-5-14-26-20-9-7-6-8-19(20)25-22(26)12-13-24-23(27)16-28-21-15-17(2)10-11-18(21)3/h6-11,15H,4-5,12-14,16H2,1-3H3,(H,24,27) |
| InChIKey | MSQBUSWCAMGOQV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |