C32H39N3O3 — CID 16993088
2-(2,5-dimethylphenoxy)-N-[5-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993088) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[5-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[5-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993088 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[5-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | Cc1ccc(OCCCn2c(CCCCCNC(=O)COc3cc(C)ccc3C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C32H39N3O3/c1-24-14-17-27(18-15-24)37-21-9-20-35-29-11-7-6-10-28(29)34-31(35)12-5-4-8-19-33-32(36)23-38-30-22-25(2)13-16-26(30)3/h6-7,10-11,13-18,22H,4-5,8-9,12,19-21,23H2,1-3H3,(H,33,36) |
| InChIKey | IMPXKWWHZVGLKR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|