C30H43N3O2 — CID 16993007
2-(2,5-dimethylphenoxy)-N-[5-(1-octylbenzimidazol-2-yl)pentyl]acetamide (PubChem CID 16993007) has the molecular formula C30H43N3O2 and a molecular weight of 477.69 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[5-(1-octylbenzimidazol-2-yl)pentyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[5-(1-octylbenzimidazol-2-yl)pentyl]acetamide |
|---|---|
| PubChem CID | 16993007 |
| Molecular Formula | C30H43N3O2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[5-(1-octylbenzimidazol-2-yl)pentyl]acetamide |
| SMILES | CCCCCCCCn1c(CCCCCNC(=O)COc2cc(C)ccc2C)nc2ccccc21 |
| InChI | InChI=1S/C30H43N3O2/c1-4-5-6-7-8-14-21-33-27-16-12-11-15-26(27)32-29(33)17-10-9-13-20-31-30(34)23-35-28-22-24(2)18-19-25(28)3/h11-12,15-16,18-19,22H,4-10,13-14,17,20-21,23H2,1-3H3,(H,31,34) |
| InChIKey | YTIHAUXYDMZLKA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|