C24H29N3O4 — CID 16986686
ethyl 2-[2-[3-[[2-(2,5-dimethylphenoxy)acetyl]amino]propyl]benzimidazol-1-yl]acetate (PubChem CID 16986686) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[2-(2,5-dimethylphenoxy)acetyl]amino]propyl]benzimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[2-[3-[[2-(2,5-dimethylphenoxy)acetyl]amino]propyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 16986686 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | ethyl 2-[2-[3-[[2-(2,5-dimethylphenoxy)acetyl]amino]propyl]benzimidazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(CCCNC(=O)COc2cc(C)ccc2C)nc2ccccc21 |
| InChI | InChI=1S/C24H29N3O4/c1-4-30-24(29)15-27-20-9-6-5-8-19(20)26-22(27)10-7-13-25-23(28)16-31-21-14-17(2)11-12-18(21)3/h5-6,8-9,11-12,14H,4,7,10,13,15-16H2,1-3H3,(H,25,28) |
| InChIKey | HMWFLOHASPJJHW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|